CAS 92084-99-6 appears in our catalog under these names: 4-Phenylpyrimidine-5-carboxylic acid, 4-Phenylpyrimidine-5-carboxylic acid 95%, 4-Phenylpyrimidine-5-carboxylic acid, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
4-phenylpyrimidine-5-carboxylic acid (CAS 92084-99-6) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 4-phenylpyrimidine-5-carboxylic acid. InChIKey: PDTTUTBMTVDZKV-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 4-phenylpyrimidine-5-carboxylic acid |
| InChIKey | PDTTUTBMTVDZKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=NC=C2C(=O)O |
Computed by PubChem (NCBI)