CAS 92115-21-4 is the registry number for N,3-dimethyl-N-phenylaniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N,3-dimethyl-N-phenylaniline (CAS 92115-21-4) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: N,3-dimethyl-N-phenylaniline. InChIKey: WTQXGXFDLZBWJI-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | N,3-dimethyl-N-phenylaniline |
| InChIKey | WTQXGXFDLZBWJI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)