Products 921939-08-4
CAS 921939-08-4 is the registry number for 1-Methyl-5-phenoxy-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
1-methyl-5-phenoxy-3-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 921939-08-4) is a chemical compound with the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. IUPAC name: 1-methyl-5-phenoxy-3-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: JLFWKPKAZSVCKI-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O3 |
|---|---|
| Molecular weight | 286.21 g/mol |
| IUPAC name | 1-methyl-5-phenoxy-3-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | JLFWKPKAZSVCKI-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(F)(F)F)C(=O)O)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)