CAS 923214-14-6 is the registry number for 6-Bromo-4-chloro-7-hydroxy-3-methyl-2,3-dihydro-1H-inden-1-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-bromo-4-chloro-7-hydroxy-3-methyl-2,3-dihydroinden-1-one (CAS 923214-14-6) is a chemical compound with the molecular formula C10H8BrClO2 and a molecular weight of 275.52 g/mol. IUPAC name: 6-bromo-4-chloro-7-hydroxy-3-methyl-2,3-dihydroinden-1-one. InChIKey: NEKQPXLINNFQMF-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClO2 |
|---|---|
| Molecular weight | 275.52 g/mol |
| IUPAC name | 6-bromo-4-chloro-7-hydroxy-3-methyl-2,3-dihydroinden-1-one |
| InChIKey | NEKQPXLINNFQMF-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C1C(=CC(=C2O)Br)Cl |
Computed by PubChem (NCBI)