CAS 923249-35-8 is the registry number for 6-Oxo-1-(prop-2-yn-1-yl)-1,4,5,6-tetrahydropyridazine-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
6-oxo-1-prop-2-ynyl-4,5-dihydropyridazine-3-carboxylic acid (CAS 923249-35-8) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 6-oxo-1-prop-2-ynyl-4,5-dihydropyridazine-3-carboxylic acid. InChIKey: JFIWGWZCBZGMRN-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 6-oxo-1-prop-2-ynyl-4,5-dihydropyridazine-3-carboxylic acid |
| InChIKey | JFIWGWZCBZGMRN-UHFFFAOYSA-N |
| SMILES | C#CCN1C(=O)CCC(=N1)C(=O)O |
Computed by PubChem (NCBI)