Products 923282-09-1
CAS 923282-09-1 appears in our catalog under these names: Dopamine Impurity 8-d10 (Dibenzylamine-d10), Dibenzylamine-d10. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 5mg, 10mg, 25 mg, 5 mg, 10 mg.
1-(2,3,4,5,6-pentadeuteriophenyl)-N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]methanamine (CAS 923282-09-1) is a chemical compound with the molecular formula C14H15N and a molecular weight of 207.34 g/mol. IUPAC name: 1-(2,3,4,5,6-pentadeuteriophenyl)-N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]methanamine. InChIKey: BWLUMTFWVZZZND-LHNTUAQVSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 207.34 g/mol |
| IUPAC name | 1-(2,3,4,5,6-pentadeuteriophenyl)-N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]methanamine |
| InChIKey | BWLUMTFWVZZZND-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CNCC2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)