CAS 923832-17-1 is the registry number for 2,5-Dimethyl-1-(2,3,4-trifluorophenyl)-1H-pyrrole-3-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,5-dimethyl-1-(2,3,4-trifluorophenyl)pyrrole-3-carbaldehyde (CAS 923832-17-1) is a chemical compound with the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. IUPAC name: 2,5-dimethyl-1-(2,3,4-trifluorophenyl)pyrrole-3-carbaldehyde. InChIKey: ZKNITCGSHSEZJE-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | 2,5-dimethyl-1-(2,3,4-trifluorophenyl)pyrrole-3-carbaldehyde |
| InChIKey | ZKNITCGSHSEZJE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=C(C(=C(C=C2)F)F)F)C)C=O |
Computed by PubChem (NCBI)