CAS 92462-70-9 appears in our catalog under these names: 5–(tert–Butyl)–1H–indole, 5-(tert-Butyl)-1H-indole 95%, 5-(tert-Butyl)-1H-indole, 95%, 95%, 5-TERT-BUTYL-1H-INDOLE, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-tert-butyl-1H-indole (CAS 92462-70-9) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 5-tert-butyl-1H-indole. InChIKey: QXJXPMHKYYMECP-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 5-tert-butyl-1H-indole |
| InChIKey | QXJXPMHKYYMECP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)NC=C2 |
Computed by PubChem (NCBI)