Products 924644-70-2

CAS 924644-70-2 is the registry number for 1-(4-Fluorophenyl)-5-propyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-(4-fluorophenyl)-5-propylpyrazole-4-carboxylic acid (CAS 924644-70-2) is a chemical compound with the molecular formula C13H13FN2O2 and a molecular weight of 248.25 g/mol. IUPAC name: 1-(4-fluorophenyl)-5-propylpyrazole-4-carboxylic acid. InChIKey: VEORDRZPVCZNOY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13FN2O2
Molecular weight248.25 g/mol
IUPAC name1-(4-fluorophenyl)-5-propylpyrazole-4-carboxylic acid
InChIKeyVEORDRZPVCZNOY-UHFFFAOYSA-N
SMILESCCCC1=C(C=NN1C2=CC=C(C=C2)F)C(=O)O

Computed by PubChem (NCBI)