Products 924861-91-6
CAS 924861-91-6 is the registry number for 5-(1-Hydroxy-cyclohexyl)-isoxazole-3-carboxylic acid amide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(1-hydroxycyclohexyl)-1,2-oxazole-3-carboxamide (CAS 924861-91-6) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: 5-(1-hydroxycyclohexyl)-1,2-oxazole-3-carboxamide. InChIKey: PEAQWCVJGOGQAV-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 5-(1-hydroxycyclohexyl)-1,2-oxazole-3-carboxamide |
| InChIKey | PEAQWCVJGOGQAV-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC(=NO2)C(=O)N)O |
Computed by PubChem (NCBI)