Products 92539-18-9
CAS 92539-18-9 is the registry number for 1-(4-Nitrobenzyl)piperidin-4-amine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
1-[(4-nitrophenyl)methyl]piperidin-4-amine (CAS 92539-18-9) is a chemical compound with the molecular formula C12H17N3O2 and a molecular weight of 235.28 g/mol. IUPAC name: 1-[(4-nitrophenyl)methyl]piperidin-4-amine. InChIKey: UHIQIZHKFBGXFN-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O2 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 1-[(4-nitrophenyl)methyl]piperidin-4-amine |
| InChIKey | UHIQIZHKFBGXFN-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)CC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)