Products 925603-42-5
CAS 925603-42-5 is the registry number for (4-(2,5-dimethylphenyl)piperazinyl)-N-(4-methylphenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-(2,5-dimethylphenyl)-N-(4-methylphenyl)piperazine-1-carboxamide (CAS 925603-42-5) is a chemical compound with the molecular formula C20H25N3O and a molecular weight of 323.4 g/mol. IUPAC name: 4-(2,5-dimethylphenyl)-N-(4-methylphenyl)piperazine-1-carboxamide. InChIKey: MJARQNDPLULXNT-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 4-(2,5-dimethylphenyl)-N-(4-methylphenyl)piperazine-1-carboxamide |
| InChIKey | MJARQNDPLULXNT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)N2CCN(CC2)C3=C(C=CC(=C3)C)C |
Computed by PubChem (NCBI)