Products 92569-10-3
CAS 92569-10-3 is the registry number for Metamizole Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
2-(N-[acetyl(methyl)amino]anilino)-N-methyl-2-oxoacetamide (CAS 92569-10-3) is a chemical compound with the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. IUPAC name: 2-(N-[acetyl(methyl)amino]anilino)-N-methyl-2-oxoacetamide. InChIKey: RGWISHPYJMVKGM-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O3 |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 2-(N-[acetyl(methyl)amino]anilino)-N-methyl-2-oxoacetamide |
| InChIKey | RGWISHPYJMVKGM-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)N(C1=CC=CC=C1)C(=O)C(=O)NC |
Computed by PubChem (NCBI)
Synonyms:
Metamizole Impurity 13