CAS 926203-17-0 appears in our catalog under these names: 4-Amino-2-chloro-N-methylbenzamide, 98%, 4-amino-2-chloro-n-methylbenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g, 2,5g.
4-amino-2-chloro-N-methylbenzamide (CAS 926203-17-0) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 4-amino-2-chloro-N-methylbenzamide. InChIKey: JXNJWSIYNDYGMK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 4-amino-2-chloro-N-methylbenzamide |
| InChIKey | JXNJWSIYNDYGMK-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)