CAS 926212-87-5 appears in our catalog under these names: N-(3-Aminophenyl)furan-3-carboxamide, 95%, N-(3-Aminophenyl)furan-3-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
N-(3-aminophenyl)furan-3-carboxamide (CAS 926212-87-5) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: N-(3-aminophenyl)furan-3-carboxamide. InChIKey: PJCAHHYYWBCYGX-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | N-(3-aminophenyl)furan-3-carboxamide |
| InChIKey | PJCAHHYYWBCYGX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=COC=C2)N |
Computed by PubChem (NCBI)