CAS 926215-48-7 appears in our catalog under these names: 3-Chloro-N'-hydroxy-4,5-dimethoxybenzene-1-carboximidamide, 95%, 3-Chloro-N'-hydroxy-4,5-dimethoxybenzene-1-carboximidamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-chloro-N'-hydroxy-4,5-dimethoxybenzenecarboximidamide (CAS 926215-48-7) is a chemical compound with the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. IUPAC name: 3-chloro-N'-hydroxy-4,5-dimethoxybenzenecarboximidamide. InChIKey: WLKRZZMZLQWUCX-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O3 |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 3-chloro-N'-hydroxy-4,5-dimethoxybenzenecarboximidamide |
| InChIKey | WLKRZZMZLQWUCX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)/C(=N/O)/N)Cl)OC |
Computed by PubChem (NCBI)