Products 926218-95-3
CAS 926218-95-3 appears in our catalog under these names: 4-Amino-2-chloro-N-(isobutyl)benzamide, 98%, 4-Amino-2-chloro-N-(2-methylpropyl)benzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g.
4-amino-2-chloro-N-(2-methylpropyl)benzamide (CAS 926218-95-3) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: 4-amino-2-chloro-N-(2-methylpropyl)benzamide. InChIKey: RVCMRMJVIZDNEK-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 4-amino-2-chloro-N-(2-methylpropyl)benzamide |
| InChIKey | RVCMRMJVIZDNEK-UHFFFAOYSA-N |
| SMILES | CC(C)CNC(=O)C1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)