CAS 926231-58-5 appears in our catalog under these names: 4-Amino-2-chloro-N,N-diethylbenzamide, 98%, 4-Amino-2-chloro-N,N-diethylbenzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g, 2,5g.
4-amino-2-chloro-N,N-diethylbenzamide (CAS 926231-58-5) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: 4-amino-2-chloro-N,N-diethylbenzamide. InChIKey: RJFITOJPVXDCPN-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 4-amino-2-chloro-N,N-diethylbenzamide |
| InChIKey | RJFITOJPVXDCPN-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)