Products 78551-58-3
CAS 78551-58-3 is the registry number for 1-Benzylpiperazin-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 100g.
1-benzylpiperazin-2-one;hydrochloride (CAS 78551-58-3) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: 1-benzylpiperazin-2-one;hydrochloride. InChIKey: IDUUIDSBIFYYIO-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 1-benzylpiperazin-2-one;hydrochloride |
| InChIKey | IDUUIDSBIFYYIO-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-Benzyl-2-oxopiperazine Hydrochloride, 1-Benzylpiperazin-2-one, HCl, 1-Benzyl-2-piperazinone hydrochloride, 1-benzylpiperazin-2-one;hydrochloride, Piperazinone, 1-(phenylmethyl)-, monohydrochloride, IDUUIDSBIFYYIO-UHFFFAOYSA-N, l-benzyl-2-piperazinone hydrochloride, 1-(Phenylmethyl)piperazinone hydrochloride, 1-(phenylmethyl)-2-Piperazinone hydrochloride