CAS 926247-18-9 appears in our catalog under these names: 1-(4-tert-Butylphenyl)cyclobutane-1-carboxylic acid, 98%, 1-(4-tert-Butylphenyl)cyclobutane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-(4-tert-butylphenyl)cyclobutane-1-carboxylic acid (CAS 926247-18-9) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: 1-(4-tert-butylphenyl)cyclobutane-1-carboxylic acid. InChIKey: FNPWYYZPIAIQJD-UHFFFAOYSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)cyclobutane-1-carboxylic acid |
| InChIKey | FNPWYYZPIAIQJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2(CCC2)C(=O)O |
Computed by PubChem (NCBI)