CAS 926249-69-6 appears in our catalog under these names: 4-Amino-n-isobutyl-3-methylbenzamide, 95%, 4-Amino-N-isobutyl-3-methylbenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
4-amino-3-methyl-N-(2-methylpropyl)benzamide (CAS 926249-69-6) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: 4-amino-3-methyl-N-(2-methylpropyl)benzamide. InChIKey: IZPMKWBCJMILPC-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 4-amino-3-methyl-N-(2-methylpropyl)benzamide |
| InChIKey | IZPMKWBCJMILPC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)NCC(C)C)N |
Computed by PubChem (NCBI)