Products 926271-03-6
CAS 926271-03-6 appears in our catalog under these names: 6-(2,6-Dimethylmorpholin-4-yl)pyridine-3-carboxylic acid, 6-(2,6-Dimethylmorpholin-4-yl)pyridine-3-carboxylic acid, 98%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 100mg, 1g.
6-(2,6-dimethylmorpholin-4-yl)pyridine-3-carboxylic acid (CAS 926271-03-6) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: 6-(2,6-dimethylmorpholin-4-yl)pyridine-3-carboxylic acid. InChIKey: ZABGXMCXGREUAJ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 6-(2,6-dimethylmorpholin-4-yl)pyridine-3-carboxylic acid |
| InChIKey | ZABGXMCXGREUAJ-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)