CAS 926922-37-4 appears in our catalog under these names: 1-Boc-4-Bromo-1H-indazole, 97%, Tert–butyl 4–bromo–1H–indazole–1–carboxylate, 1H-Indazole-1-carboxylic acid, 4-bromo-, 1,1-dimethylethyl ester, 97%, 97%. Offered by: Fluorochem, GLPBio, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
Tert-butyl 4-bromoindazole-1-carboxylate (CAS 926922-37-4) is a chemical compound with the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. IUPAC name: tert-butyl 4-bromoindazole-1-carboxylate. InChIKey: OFVPGIHEBLOESV-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2 |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | tert-butyl 4-bromoindazole-1-carboxylate |
| InChIKey | OFVPGIHEBLOESV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=N1)C(=CC=C2)Br |
Computed by PubChem (NCBI)