CAS 92695-50-6 is the registry number for 1,2-Dihydro-1,10-phenanthrolin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1H-1,10-phenanthrolin-2-one (CAS 92695-50-6) is a chemical compound with the molecular formula C12H8N2O and a molecular weight of 196.20 g/mol. IUPAC name: 1H-1,10-phenanthrolin-2-one. InChIKey: FBKKYZMTAAQTJO-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 1H-1,10-phenanthrolin-2-one |
| InChIKey | FBKKYZMTAAQTJO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=C2)C=CC(=O)N3)N=C1 |
Computed by PubChem (NCBI)