Products 927819-39-4

CAS 927819-39-4 is the registry number for Androgen receptor allosteric antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[5-(2-methoxyphenyl)-1-(2-methylpropyl)indol-3-yl]acetamide (CAS 927819-39-4) is a chemical compound with the molecular formula C21H24N2O2 and a molecular weight of 336.4 g/mol. IUPAC name: 2-[5-(2-methoxyphenyl)-1-(2-methylpropyl)indol-3-yl]acetamide. InChIKey: VVFSMYPKXKRBFB-UHFFFAOYSA-N.

Identity
Molecular formulaC21H24N2O2
Molecular weight336.4 g/mol
IUPAC name2-[5-(2-methoxyphenyl)-1-(2-methylpropyl)indol-3-yl]acetamide
InChIKeyVVFSMYPKXKRBFB-UHFFFAOYSA-N
SMILESCC(C)CN1C=C(C2=C1C=CC(=C2)C3=CC=CC=C3OC)CC(=O)N

Computed by PubChem (NCBI)