CAS 927969-20-8 appears in our catalog under these names: 2-{(2-(trifluoromethyl)quinazolin-4-yl)amino}acetic acid, 98%, 2-{(2-(Trifluoromethyl)quinazolin-4-yl)amino}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 250mg, 2,5g.
2-[[2-(trifluoromethyl)quinazolin-4-yl]amino]acetic acid (CAS 927969-20-8) is a chemical compound with the molecular formula C11H8F3N3O2 and a molecular weight of 271.19 g/mol. IUPAC name: 2-[[2-(trifluoromethyl)quinazolin-4-yl]amino]acetic acid. InChIKey: BTRMSWZRDKORIF-UHFFFAOYSA-N.
| Molecular formula | C11H8F3N3O2 |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | 2-[[2-(trifluoromethyl)quinazolin-4-yl]amino]acetic acid |
| InChIKey | BTRMSWZRDKORIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)C(F)(F)F)NCC(=O)O |
Computed by PubChem (NCBI)