CAS 927982-67-0 is the registry number for 4-((6-Methylpyrimidin-4-yl)oxy)aniline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(6-methylpyrimidin-4-yl)oxyaniline (CAS 927982-67-0) is a chemical compound with the molecular formula C11H11N3O and a molecular weight of 201.22 g/mol. IUPAC name: 4-(6-methylpyrimidin-4-yl)oxyaniline. InChIKey: LQASPOUZJYIRMK-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 4-(6-methylpyrimidin-4-yl)oxyaniline |
| InChIKey | LQASPOUZJYIRMK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=N1)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)