CAS 928054-32-4 is the registry number for ((1R,2R)-2-Phenylcyclopropyl)methanamine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[(1R,2R)-2-phenylcyclopropyl]methanamine;hydrochloride (CAS 928054-32-4) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: [(1R,2R)-2-phenylcyclopropyl]methanamine;hydrochloride. InChIKey: IQFBVCYZPKNMIN-IYPAPVHQSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | [(1R,2R)-2-phenylcyclopropyl]methanamine;hydrochloride |
| InChIKey | IQFBVCYZPKNMIN-IYPAPVHQSA-N |
| SMILES | C1[C@H]([C@@H]1C2=CC=CC=C2)CN.Cl |
Computed by PubChem (NCBI)