Products 928054-33-5
CAS 928054-33-5 is the registry number for ((1S,2S)-2-Phenylcyclopropyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(1S,2S)-2-phenylcyclopropyl]methanamine;hydrochloride (CAS 928054-33-5) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: [(1S,2S)-2-phenylcyclopropyl]methanamine;hydrochloride. InChIKey: IQFBVCYZPKNMIN-DHTOPLTISA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | [(1S,2S)-2-phenylcyclopropyl]methanamine;hydrochloride |
| InChIKey | IQFBVCYZPKNMIN-DHTOPLTISA-N |
| SMILES | C1[C@@H]([C@H]1C2=CC=CC=C2)CN.Cl |
Computed by PubChem (NCBI)