CAS 928664-12-4 appears in our catalog under these names: 1-(Bromomethyl)-3-methoxy-5-nitrobenzene, 95+%, 1–(Bromomethyl)–3–methoxy–5–nitrobenzene. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 250mg.
1-(bromomethyl)-3-methoxy-5-nitrobenzene (CAS 928664-12-4) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 1-(bromomethyl)-3-methoxy-5-nitrobenzene. InChIKey: AXVLGWFXBNZIMX-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 1-(bromomethyl)-3-methoxy-5-nitrobenzene |
| InChIKey | AXVLGWFXBNZIMX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)