Products 929973-63-7
CAS 929973-63-7 is the registry number for 5,6,7-Trimethyl-6H-pyrrolo(3,4-d)pyridazine-1-thiol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5,6,7-trimethyl-2H-pyrrolo[3,4-d]pyridazine-1-thione (CAS 929973-63-7) is a chemical compound with the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. IUPAC name: 5,6,7-trimethyl-2H-pyrrolo[3,4-d]pyridazine-1-thione. InChIKey: WTAGVWQSFFPINR-UHFFFAOYSA-N.
| Molecular formula | C9H11N3S |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | 5,6,7-trimethyl-2H-pyrrolo[3,4-d]pyridazine-1-thione |
| InChIKey | WTAGVWQSFFPINR-UHFFFAOYSA-N |
| SMILES | CC1=C2C=NNC(=S)C2=C(N1C)C |
Computed by PubChem (NCBI)