CAS 93-36-7 is the registry number for 7-Amino-2-naphthol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
7-aminonaphthalen-2-ol (CAS 93-36-7) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 7-aminonaphthalen-2-ol. InChIKey: WSUYONLKFXZZRV-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 7-aminonaphthalen-2-ol |
| InChIKey | WSUYONLKFXZZRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)O)N |
Computed by PubChem (NCBI)