Products 93019-46-6

CAS 93019-46-6 is the registry number for Octopamine Impurity 1. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-[5-(4-hydroxyphenyl)piperazin-2-yl]phenol (CAS 93019-46-6) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: 4-[5-(4-hydroxyphenyl)piperazin-2-yl]phenol. InChIKey: FPPBMXVCCCEYJD-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18N2O2
Molecular weight270.33 g/mol
IUPAC name4-[5-(4-hydroxyphenyl)piperazin-2-yl]phenol
InChIKeyFPPBMXVCCCEYJD-UHFFFAOYSA-N
SMILESC1C(NCC(N1)C2=CC=C(C=C2)O)C3=CC=C(C=C3)O

Computed by PubChem (NCBI)