CAS 94572-68-6 appears in our catalog under these names: 2,5-Bis(4-hydroxyphenyl)piperazine dihydrochloride, 98%, 2,5-Bis(4-hydroxyphenyl)piperazine Dihydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g, 500mg.
4-[5-(4-hydroxyphenyl)piperazin-2-yl]phenol (CAS 94572-68-6) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: 4-[5-(4-hydroxyphenyl)piperazin-2-yl]phenol. InChIKey: FPPBMXVCCCEYJD-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O2 |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | 4-[5-(4-hydroxyphenyl)piperazin-2-yl]phenol |
| InChIKey | FPPBMXVCCCEYJD-UHFFFAOYSA-N |
| SMILES | C1C(NCC(N1)C2=CC=C(C=C2)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)