Products 931105-37-2
CAS 931105-37-2 appears in our catalog under these names: Methyl 5–bromo–2–fluoronicotinate, Methyl 5-bromo-2-fluoronicotinate 98%, Methyl 5-bromo-2-fluoronicotinate, 98%, 3-Pyridinecarboxylic acid, 5-bromo-2-fluoro-, methyl ester, 98%, 98%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g, 100mg.
Methyl 5-bromo-2-fluoropyridine-3-carboxylate (CAS 931105-37-2) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: methyl 5-bromo-2-fluoropyridine-3-carboxylate. InChIKey: QWPLSFRRQYGYTD-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | methyl 5-bromo-2-fluoropyridine-3-carboxylate |
| InChIKey | QWPLSFRRQYGYTD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)Br)F |
Computed by PubChem (NCBI)