Products 931313-78-9
CAS 931313-78-9 is the registry number for tert-Butyl 2-(4-methoxyphenyl)-3-oxo-1,4,8-triazaspiro[4.5]dec-1-ene-8-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 3-(4-methoxyphenyl)-2-oxo-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate (CAS 931313-78-9) is a chemical compound with the molecular formula C19H25N3O4 and a molecular weight of 359.4 g/mol. IUPAC name: tert-butyl 3-(4-methoxyphenyl)-2-oxo-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate. InChIKey: CDCCZNFEXVOQAA-UHFFFAOYSA-N.
| Molecular formula | C19H25N3O4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | tert-butyl 3-(4-methoxyphenyl)-2-oxo-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate |
| InChIKey | CDCCZNFEXVOQAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)NC(=O)C(=N2)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)