CAS 172041-72-4 is the registry number for Methyl 2,6-bis((S)-4-isopropyl-4,5-dihydrooxazol-2-yl)isonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,6-bis[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyridine-4-carboxylate (CAS 172041-72-4) is a chemical compound with the molecular formula C19H25N3O4 and a molecular weight of 359.4 g/mol. IUPAC name: methyl 2,6-bis[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyridine-4-carboxylate. InChIKey: UJPTVLCTHWRDSK-HZPDHXFCSA-N.
| Molecular formula | C19H25N3O4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | methyl 2,6-bis[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyridine-4-carboxylate |
| InChIKey | UJPTVLCTHWRDSK-HZPDHXFCSA-N |
| SMILES | CC(C)[C@H]1COC(=N1)C2=CC(=CC(=N2)C3=N[C@H](CO3)C(C)C)C(=O)OC |
Computed by PubChem (NCBI)