Products 396073-89-5
CAS 396073-89-5 appears in our catalog under these names: Bn82002, 95%, BN82002/ 99.91% (existing batch purity), CDC25 Phosphatase Inhibitor I, BN82002, 4-(Dimethylamino)-2-methoxy-6-[[methyl[2-(4-nitrophenyl)ethyl]amino]methyl]phenol, CDC25 Phosphatase Inhibitor 1PC X 5MG. Offered by: Combi-blocks, TargetMol, Biosynth, Chemat, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg.
4-(dimethylamino)-2-methoxy-6-[[methyl-[2-(4-nitrophenyl)ethyl]amino]methyl]phenol (CAS 396073-89-5) is a chemical compound with the molecular formula C19H25N3O4 and a molecular weight of 359.4 g/mol. IUPAC name: 4-(dimethylamino)-2-methoxy-6-[[methyl-[2-(4-nitrophenyl)ethyl]amino]methyl]phenol. InChIKey: GOKYHQGRIIXMNE-UHFFFAOYSA-N.
| Molecular formula | C19H25N3O4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 4-(dimethylamino)-2-methoxy-6-[[methyl-[2-(4-nitrophenyl)ethyl]amino]methyl]phenol |
| InChIKey | GOKYHQGRIIXMNE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C(=C1)OC)O)CN(C)CCC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)