CAS 21037-26-3 is the registry number for 3,4-Xylyl-6-phenylazo-D-ribitylamine, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.
(2R,3S,4S)-5-(4,5-dimethyl-2-phenyldiazenylanilino)pentane-1,2,3,4-tetrol (CAS 21037-26-3) is a chemical compound with the molecular formula C19H25N3O4 and a molecular weight of 359.4 g/mol. IUPAC name: (2R,3S,4S)-5-(4,5-dimethyl-2-phenyldiazenylanilino)pentane-1,2,3,4-tetrol. InChIKey: NARUXRZZSJCXFJ-OTWHNJEPSA-N.
| Molecular formula | C19H25N3O4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | (2R,3S,4S)-5-(4,5-dimethyl-2-phenyldiazenylanilino)pentane-1,2,3,4-tetrol |
| InChIKey | NARUXRZZSJCXFJ-OTWHNJEPSA-N |
| SMILES | CC1=CC(=C(C=C1C)N=NC2=CC=CC=C2)NC[C@@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)