CAS 933685-28-0 is the registry number for 2-(2-Phenylethyl)-1,3-thiazole-5-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2-phenylethyl)-1,3-thiazole-5-carbaldehyde (CAS 933685-28-0) is a chemical compound with the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. IUPAC name: 2-(2-phenylethyl)-1,3-thiazole-5-carbaldehyde. InChIKey: VBKZDVNAQVOHPQ-UHFFFAOYSA-N.
| Molecular formula | C12H11NOS |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 2-(2-phenylethyl)-1,3-thiazole-5-carbaldehyde |
| InChIKey | VBKZDVNAQVOHPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=NC=C(S2)C=O |
Computed by PubChem (NCBI)