Products 933710-78-2
CAS 933710-78-2 appears in our catalog under these names: 2-Chloro-1H-benzo[d]imidazole-5-carboxylic acid, 95%, 2-Chloro-1H-benzo[d]imidazole-6-carboxylic acid, 97%, 2-Chloro-1H-benzo[d]imidazole-6-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g.
2-chloro-3H-benzimidazole-5-carboxylic acid (CAS 933710-78-2) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 2-chloro-3H-benzimidazole-5-carboxylic acid. InChIKey: QNLZXSMWOUVWPF-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 2-chloro-3H-benzimidazole-5-carboxylic acid |
| InChIKey | QNLZXSMWOUVWPF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=N2)Cl |
Computed by PubChem (NCBI)