CAS 933726-72-8 appears in our catalog under these names: 3,4-Dihydro-1H-2-benzopyran-6-carboxylic acid, 3,4-dihydro-1H-2-benzopyran-6-carboxylic acid, 95%, 95%, Isochromane-6-carboxylic acid, 96%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
3,4-dihydro-1H-isochromene-6-carboxylic acid (CAS 933726-72-8) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 3,4-dihydro-1H-isochromene-6-carboxylic acid. InChIKey: OKAXESAODCHISR-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 3,4-dihydro-1H-isochromene-6-carboxylic acid |
| InChIKey | OKAXESAODCHISR-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)