Products 933734-96-4
CAS 933734-96-4 is the registry number for 2-(5-Phenyl-1,3,4-oxadiazol-2-yl)ethan-1-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethanamine (CAS 933734-96-4) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethanamine. InChIKey: NILJMXPWRIBPKC-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethanamine |
| InChIKey | NILJMXPWRIBPKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)CCN |
Computed by PubChem (NCBI)