CAS 933911-63-8 is the registry number for 5-(2-Chloroethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-chloroethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole (CAS 933911-63-8) is a chemical compound with the molecular formula C10H8Cl2N2O and a molecular weight of 243.09 g/mol. IUPAC name: 5-(2-chloroethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole. InChIKey: CPRQIQWGQZFEKC-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | 5-(2-chloroethyl)-3-(2-chlorophenyl)-1,2,4-oxadiazole |
| InChIKey | CPRQIQWGQZFEKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)CCCl)Cl |
Computed by PubChem (NCBI)