CAS 934606-28-7 is the registry number for 2-Chloro-N-hydroxy-4-methoxybenzimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N'-hydroxy-4-methoxybenzenecarboximidamide (CAS 934606-28-7) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 2-chloro-N'-hydroxy-4-methoxybenzenecarboximidamide. InChIKey: DJWZUVZMVGWNOJ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-chloro-N'-hydroxy-4-methoxybenzenecarboximidamide |
| InChIKey | DJWZUVZMVGWNOJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=NO)N)Cl |
Computed by PubChem (NCBI)