Products 934634-29-4
CAS 934634-29-4 appears in our catalog under these names: Sinapyl alcohol–d3, Sinapyl alcohol-d3, 85.09%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 10 mg, 5 mg.
4-[(E)-3-hydroxyprop-1-enyl]-2-methoxy-6-(trideuteriomethoxy)phenol (CAS 934634-29-4) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 213.24 g/mol. IUPAC name: 4-[(E)-3-hydroxyprop-1-enyl]-2-methoxy-6-(trideuteriomethoxy)phenol. InChIKey: LZFOPEXOUVTGJS-VGIDZVCYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 213.24 g/mol |
| IUPAC name | 4-[(E)-3-hydroxyprop-1-enyl]-2-methoxy-6-(trideuteriomethoxy)phenol |
| InChIKey | LZFOPEXOUVTGJS-VGIDZVCYSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C(=CC(=C1)/C=C/CO)OC)O |
Computed by PubChem (NCBI)
Synonyms:
Sinapyl alcohol-d3