Products 934660-14-7
CAS 934660-14-7 appears in our catalog under these names: 5-Bromo-6-methylbenzofuran-2-carboxylic acid, 5-Bromo-6-methylbenzofuran-2-carboxylic acid, 95%, 5-Bromo-6-methylbenzofuran-2-carboxylic acid, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-6-methyl-1-benzofuran-2-carboxylic acid (CAS 934660-14-7) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: 5-bromo-6-methyl-1-benzofuran-2-carboxylic acid. InChIKey: DGXROTMKWYCUIC-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | 5-bromo-6-methyl-1-benzofuran-2-carboxylic acid |
| InChIKey | DGXROTMKWYCUIC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)C=C(O2)C(=O)O |
Computed by PubChem (NCBI)