Products 936128-98-2

CAS 936128-98-2 is the registry number for Methyl 3-(piperidin-4-yloxy)benzoate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.

Methyl 3-piperidin-4-yloxybenzoate;hydrochloride (CAS 936128-98-2) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: methyl 3-piperidin-4-yloxybenzoate;hydrochloride. InChIKey: RVEADBKOIBZGJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18ClNO3
Molecular weight271.74 g/mol
IUPAC namemethyl 3-piperidin-4-yloxybenzoate;hydrochloride
InChIKeyRVEADBKOIBZGJQ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=CC=C1)OC2CCNCC2.Cl

Computed by PubChem (NCBI)