Products 93629-17-5
CAS 93629-17-5 is the registry number for (3,5-di-tert-butyl-4-methoxyphenyl)methanol, 97%+(GC),RG, 97%+(GC),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3,5-ditert-butyl-4-methoxyphenyl)methanol (CAS 93629-17-5) is a chemical compound with the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. IUPAC name: (3,5-ditert-butyl-4-methoxyphenyl)methanol. InChIKey: RFEYGJGHESCXRB-UHFFFAOYSA-N.
| Molecular formula | C16H26O2 |
|---|---|
| Molecular weight | 250.38 g/mol |
| IUPAC name | (3,5-ditert-butyl-4-methoxyphenyl)methanol |
| InChIKey | RFEYGJGHESCXRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1OC)C(C)(C)C)CO |
Computed by PubChem (NCBI)