CAS 93634-55-0 is the registry number for (Z)-4-(4-Chlorobenzylidene)-2-methyloxazol-5(4H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
(4Z)-4-[(4-chlorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one (CAS 93634-55-0) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: (4Z)-4-[(4-chlorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one. InChIKey: NWYIDAQFRYQRFT-POHAHGRESA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | (4Z)-4-[(4-chlorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one |
| InChIKey | NWYIDAQFRYQRFT-POHAHGRESA-N |
| SMILES | CC1=N/C(=C\C2=CC=C(C=C2)Cl)/C(=O)O1 |
Computed by PubChem (NCBI)